C21H22ClFN4O2 — CID 118692616
N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide (PubChem CID 118692616) has the molecular formula C21H22ClFN4O2 and a molecular weight of 416.88 g/mol. Its IUPAC name is N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide.
| Compound Name | N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide |
|---|---|
| PubChem CID | 118692616 |
| Molecular Formula | C21H22ClFN4O2 |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[5-chloro-3-(4-fluorophenyl)imidazo[4,5-b]pyridin-2-yl]-2-(6,6-dimethyloxan-2-yl)acetamide |
| SMILES | CC1(C)CCCC(CC(=O)Nc2nc3ccc(Cl)nc3n2-c2ccc(F)cc2)O1 |
| InChI | InChI=1S/C21H22ClFN4O2/c1-21(2)11-3-4-15(29-21)12-18(28)26-20-24-16-9-10-17(22)25-19(16)27(20)14-7-5-13(23)6-8-14/h5-10,15H,3-4,11-12H2,1-2H3,(H,24,26,28) |
| InChIKey | GLSXHINBSRDCAP-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|