C20H18F2N4O2 — CID 118692958
3-(3H-benzimidazol-5-yl)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 118692958) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-(3H-benzimidazol-5-yl)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-(3H-benzimidazol-5-yl)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 118692958 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-(3H-benzimidazol-5-yl)-4-[4-(3,3-difluoropyrrolidin-1-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCC(c2ccc(N3CCC(F)(F)C3)cc2)N1c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C20H18F2N4O2/c21-20(22)7-8-25(11-20)14-3-1-13(2-4-14)18-10-28-19(27)26(18)15-5-6-16-17(9-15)24-12-23-16/h1-6,9,12,18H,7-8,10-11H2,(H,23,24) |
| InChIKey | WUQNHLWXYYGXAB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|