About 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide
8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide (PubChem CID 118693028) has the molecular formula C20H23ClF2N2O2
and a molecular weight of 396.87 g/mol. Its IUPAC name is 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide.
Molecular Properties
| Compound Name | 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide |
| PubChem CID | 118693028 |
| Molecular Formula | C20H23ClF2N2O2 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide |
| SMILES | O=C(NCC1CCC(F)(F)CC1)c1cc(C2CCOC2)n2cccc(Cl)c12 |
| InChI | InChI=1S/C20H23ClF2N2O2/c21-16-2-1-8-25-17(14-5-9-27-12-14)10-15(18(16)25)19(26)24-11-13-3-6-20(22,23)7-4-13/h1-2,8,10,13-14H,3-7,9,11-12H2,(H,24,26) |
| InChIKey | IJVGSXYLMYOOAX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide?
The IUPAC name of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide (CID 118693028) is 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide.
What is the SMILES notation for 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide?
The canonical SMILES for 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide is O=C(NCC1CCC(F)(F)CC1)c1cc(C2CCOC2)n2cccc(Cl)c12.
What is the InChIKey of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide?
The InChIKey is IJVGSXYLMYOOAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23ClF2N2O2/c21-16-2-1-8-25-17(14-5-9-27-12-14)10-15(18(16)25)19(26)24-11-13-3-6-20(22,23)7-4-13/h1-2,8,10,13-14H,3-7,9,11-12H2,(H,24,26).
What are the key properties of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide?
8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide has a molecular weight of 396.87 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(oxolan-3-yl)indolizine-1-carboxamide is sourced from PubChem (CID 118693028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).