About 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide
8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide (PubChem CID 118693034) has the molecular formula C19H23ClF2N2O2
and a molecular weight of 384.85 g/mol. Its IUPAC name is 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide.
Molecular Properties
| Compound Name | 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide |
| PubChem CID | 118693034 |
| Molecular Formula | C19H23ClF2N2O2 |
| Molecular Weight | 384.85 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide |
| SMILES | COCCc1cc(C(=O)NCC2CCC(F)(F)CC2)c2c(Cl)cccn12 |
| InChI | InChI=1S/C19H23ClF2N2O2/c1-26-10-6-14-11-15(17-16(20)3-2-9-24(14)17)18(25)23-12-13-4-7-19(21,22)8-5-13/h2-3,9,11,13H,4-8,10,12H2,1H3,(H,23,25) |
| InChIKey | YNXKKKGYVKPVTH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.85 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide?
The IUPAC name of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide (CID 118693034) is 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide.
What is the SMILES notation for 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide?
The canonical SMILES for 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide is COCCc1cc(C(=O)NCC2CCC(F)(F)CC2)c2c(Cl)cccn12.
What is the InChIKey of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide?
The InChIKey is YNXKKKGYVKPVTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23ClF2N2O2/c1-26-10-6-14-11-15(17-16(20)3-2-9-24(14)17)18(25)23-12-13-4-7-19(21,22)8-5-13/h2-3,9,11,13H,4-8,10,12H2,1H3,(H,23,25).
What are the key properties of 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide?
8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide has a molecular weight of 384.85 g/mol, XLogP of 4.34, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-N-[(4,4-difluorocyclohexyl)methyl]-3-(2-methoxyethyl)indolizine-1-carboxamide is sourced from PubChem (CID 118693034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).