About 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate
3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate (PubChem CID 118693158) has the molecular formula C25H33NO4
and a molecular weight of 411.54 g/mol. Its IUPAC name is 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate |
| PubChem CID | 118693158 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)N3CCC[C@H]3C(=O)OCCC(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C25H33NO4/c1-17(18-8-9-20-16-21(29-5)11-10-19(20)15-18)23(27)26-13-6-7-22(26)24(28)30-14-12-25(2,3)4/h8-11,15-17,22H,6-7,12-14H2,1-5H3/t17-,22-/m0/s1 |
| InChIKey | VYTHNVYUDSRIGK-JTSKRJEESA-N |
| XLogP | 4.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate?
The IUPAC name of 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate (CID 118693158) is 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate?
The canonical SMILES for 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate is COc1ccc2cc([C@H](C)C(=O)N3CCC[C@H]3C(=O)OCCC(C)(C)C)ccc2c1.
What is the InChIKey of 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate?
The InChIKey is VYTHNVYUDSRIGK-JTSKRJEESA-N. The full InChI is InChI=1S/C25H33NO4/c1-17(18-8-9-20-16-21(29-5)11-10-19(20)15-18)23(27)26-13-6-7-22(26)24(28)30-14-12-25(2,3)4/h8-11,15-17,22H,6-7,12-14H2,1-5H3/t17-,22-/m0/s1.
What are the key properties of 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate?
3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate has a molecular weight of 411.54 g/mol, XLogP of 4.92, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutyl (2S)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 118693158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).