C31H45NO5 — CID 118693211
[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-[(2-methoxy-4-prop-2-enylphenoxy)carbonylamino]-3-methylbutanoate (PubChem CID 118693211) has the molecular formula C31H45NO5 and a molecular weight of 511.70 g/mol. Its IUPAC name is [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-[(2-methoxy-4-prop-2-enylphenoxy)carbonylamino]-3-methylbutanoate.
| Compound Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-[(2-methoxy-4-prop-2-enylphenoxy)carbonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118693211 |
| Molecular Formula | C31H45NO5 |
| Molecular Weight | 511.70 g/mol |
| Exact Mass | 511.33 |
| IUPAC Name | [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] 2-[(2-methoxy-4-prop-2-enylphenoxy)carbonylamino]-3-methylbutanoate |
| SMILES | C=CCc1ccc(OC(=O)NC(C(=O)OC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(C)C)c(OC)c1 |
| InChI | InChI=1S/C31H45NO5/c1-9-12-26-17-18-27(28(21-26)35-8)37-31(34)32-29(23(4)5)30(33)36-20-19-25(7)16-11-15-24(6)14-10-13-22(2)3/h9,13,15,17-19,21,23,29H,1,10-12,14,16,20H2,2-8H3,(H,32,34)/b24-15+,25-19+ |
| InChIKey | LHRIHLBNBMXOPR-QJKQFKROSA-N |
| XLogP | 7.50 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.70 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|