About 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate
5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate (PubChem CID 118693224) has the molecular formula C7H10ClN7O10
and a molecular weight of 387.65 g/mol. Its IUPAC name is 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate.
Molecular Properties
| Compound Name | 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate |
| PubChem CID | 118693224 |
| Molecular Formula | C7H10ClN7O10 |
| Molecular Weight | 387.65 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate |
| SMILES | Clc1cnnnn1.O=[N+]([O-])OCC(CO)(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C5H9N3O10.C2HClN4/c9-1-5(2-16-6(10)11,3-17-7(12)13)4-18-8(14)15;3-2-1-4-6-7-5-2/h9H,1-4H2;1H |
| InChIKey | NCSLLTVITFSTTR-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 228.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.65 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate?
The IUPAC name of 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate (CID 118693224) is 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate.
What is the SMILES notation for 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate?
The canonical SMILES for 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate is Clc1cnnnn1.O=[N+]([O-])OCC(CO)(CO[N+](=O)[O-])CO[N+](=O)[O-].
What is the InChIKey of 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate?
The InChIKey is NCSLLTVITFSTTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O10.C2HClN4/c9-1-5(2-16-6(10)11,3-17-7(12)13)4-18-8(14)15;3-2-1-4-6-7-5-2/h9H,1-4H2;1H.
What are the key properties of 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate?
5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate has a molecular weight of 387.65 g/mol, XLogP of -1.49, 10 rotatable bonds, 1 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chlorotetrazine;[2-(hydroxymethyl)-3-nitrooxy-2-(nitrooxymethyl)propyl] nitrate is sourced from PubChem (CID 118693224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).