C7H11IN2O — CID 118693309
(2R,3S)-3-(4-iodopyrazol-1-yl)butan-2-ol (PubChem CID 118693309) has the molecular formula C7H11IN2O and a molecular weight of 266.08 g/mol. Its IUPAC name is (2R,3S)-3-(4-iodopyrazol-1-yl)butan-2-ol.
| Compound Name | (2R,3S)-3-(4-iodopyrazol-1-yl)butan-2-ol |
|---|---|
| PubChem CID | 118693309 |
| Molecular Formula | C7H11IN2O |
| Molecular Weight | 266.08 g/mol |
| Exact Mass | 265.99 |
| IUPAC Name | (2R,3S)-3-(4-iodopyrazol-1-yl)butan-2-ol |
| SMILES | C[C@@H](O)[C@H](C)n1cc(I)cn1 |
| InChI | InChI=1S/C7H11IN2O/c1-5(6(2)11)10-4-7(8)3-9-10/h3-6,11H,1-2H3/t5-,6+/m0/s1 |
| InChIKey | CRPMOPSNWAWQHH-NTSWFWBYSA-N |
| XLogP | 1.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.08 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|