About trifluoromethanesulfonate;trimethyl(phenyl)azanium
trifluoromethanesulfonate;trimethyl(phenyl)azanium (PubChem CID 118693686) has the molecular formula C10H14F3NO3S
and a molecular weight of 285.29 g/mol. Its IUPAC name is trifluoromethanesulfonate;trimethyl(phenyl)azanium.
Molecular Properties
| Compound Name | trifluoromethanesulfonate;trimethyl(phenyl)azanium |
| PubChem CID | 118693686 |
| Molecular Formula | C10H14F3NO3S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | trifluoromethanesulfonate;trimethyl(phenyl)azanium |
| SMILES | C[N+](C)(C)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C9H14N.CHF3O3S/c1-10(2,3)9-7-5-4-6-8-9;2-1(3,4)8(5,6)7/h4-8H,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | REIQMNHINXXPQU-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze trifluoromethanesulfonate;trimethyl(phenyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trifluoromethanesulfonate;trimethyl(phenyl)azanium?
The IUPAC name of trifluoromethanesulfonate;trimethyl(phenyl)azanium (CID 118693686) is trifluoromethanesulfonate;trimethyl(phenyl)azanium.
What is the SMILES notation for trifluoromethanesulfonate;trimethyl(phenyl)azanium?
The canonical SMILES for trifluoromethanesulfonate;trimethyl(phenyl)azanium is C[N+](C)(C)c1ccccc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of trifluoromethanesulfonate;trimethyl(phenyl)azanium?
The InChIKey is REIQMNHINXXPQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H14N.CHF3O3S/c1-10(2,3)9-7-5-4-6-8-9;2-1(3,4)8(5,6)7/h4-8H,1-3H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of trifluoromethanesulfonate;trimethyl(phenyl)azanium?
trifluoromethanesulfonate;trimethyl(phenyl)azanium has a molecular weight of 285.29 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trifluoromethanesulfonate;trimethyl(phenyl)azanium is sourced from PubChem (CID 118693686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).