C24H19F3N4O4 — CID 118694067
methyl 5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl]benzoate (PubChem CID 118694067) has the molecular formula C24H19F3N4O4 and a molecular weight of 484.43 g/mol. Its IUPAC name is methyl 5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl]benzoate.
| Compound Name | methyl 5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl]benzoate |
|---|---|
| PubChem CID | 118694067 |
| Molecular Formula | C24H19F3N4O4 |
| Molecular Weight | 484.43 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | methyl 5-cyano-2-[3-methyl-2,5-dioxo-1-[3-(trifluoromethyl)phenyl]-4,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-yl]benzoate |
| SMILES | COC(=O)c1cc(C#N)ccc1C1C2=C(CCNC2=O)N(c2cccc(C(F)(F)F)c2)C(=O)N1C |
| InChI | InChI=1S/C24H19F3N4O4/c1-30-20(16-7-6-13(12-28)10-17(16)22(33)35-2)19-18(8-9-29-21(19)32)31(23(30)34)15-5-3-4-14(11-15)24(25,26)27/h3-7,10-11,20H,8-9H2,1-2H3,(H,29,32) |
| InChIKey | KIBQAUVMKMMWFS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |