C17H17ClN2O — CID 118694639
N-(6-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-chlorobenzamide (PubChem CID 118694639) has the molecular formula C17H17ClN2O and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(6-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-chlorobenzamide.
| Compound Name | N-(6-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-chlorobenzamide |
|---|---|
| PubChem CID | 118694639 |
| Molecular Formula | C17H17ClN2O |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | N-(6-amino-5,6,7,8-tetrahydronaphthalen-2-yl)-2-chlorobenzamide |
| SMILES | NC1CCc2cc(NC(=O)c3ccccc3Cl)ccc2C1 |
| InChI | InChI=1S/C17H17ClN2O/c18-16-4-2-1-3-15(16)17(21)20-14-8-6-11-9-13(19)7-5-12(11)10-14/h1-4,6,8,10,13H,5,7,9,19H2,(H,20,21) |
| InChIKey | JDKKOFJSWNZDKR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |