About N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide
N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide (PubChem CID 118694682) has the molecular formula C16H14F3N3O2
and a molecular weight of 337.30 g/mol. Its IUPAC name is N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| PubChem CID | 118694682 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| SMILES | N[C@H]1COc2cc(NC(=O)c3ccnc(C(F)(F)F)c3)ccc2C1 |
| InChI | InChI=1S/C16H14F3N3O2/c17-16(18,19)14-6-10(3-4-21-14)15(23)22-12-2-1-9-5-11(20)8-24-13(9)7-12/h1-4,6-7,11H,5,8,20H2,(H,22,23)/t11-/m1/s1 |
| InChIKey | ZIXMJUDJEHWBIY-LLVKDONJSA-N |
| XLogP | 2.61 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide?
The IUPAC name of N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide (CID 118694682) is N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide.
What is the SMILES notation for N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide?
The canonical SMILES for N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide is N[C@H]1COc2cc(NC(=O)c3ccnc(C(F)(F)F)c3)ccc2C1.
What is the InChIKey of N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide?
The InChIKey is ZIXMJUDJEHWBIY-LLVKDONJSA-N. The full InChI is InChI=1S/C16H14F3N3O2/c17-16(18,19)14-6-10(3-4-21-14)15(23)22-12-2-1-9-5-11(20)8-24-13(9)7-12/h1-4,6-7,11H,5,8,20H2,(H,22,23)/t11-/m1/s1.
What are the key properties of N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide?
N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide has a molecular weight of 337.30 g/mol, XLogP of 2.61, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3R)-3-amino-3,4-dihydro-2H-chromen-7-yl]-2-(trifluoromethyl)pyridine-4-carboxamide is sourced from PubChem (CID 118694682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).