C19H16N4O — CID 118696401
(3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-pyrimidin-5-yl-1H-indol-2-one (PubChem CID 118696401) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-pyrimidin-5-yl-1H-indol-2-one.
| Compound Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-pyrimidin-5-yl-1H-indol-2-one |
|---|---|
| PubChem CID | 118696401 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (3Z)-3-[(3,5-dimethyl-1H-pyrrol-2-yl)methylidene]-7-pyrimidin-5-yl-1H-indol-2-one |
| SMILES | Cc1cc(C)c(/C=C2\C(=O)Nc3c2cccc3-c2cncnc2)[nH]1 |
| InChI | InChI=1S/C19H16N4O/c1-11-6-12(2)22-17(11)7-16-15-5-3-4-14(18(15)23-19(16)24)13-8-20-10-21-9-13/h3-10,22H,1-2H3,(H,23,24)/b16-7- |
| InChIKey | LKPKMKGLFRVLPF-APSNUPSMSA-N |
| XLogP | 3.58 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|