C15H13F3N4O2 — CID 118696560
(7S)-3-[(E)-hydroxyiminomethyl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one (PubChem CID 118696560) has the molecular formula C15H13F3N4O2 and a molecular weight of 338.29 g/mol. Its IUPAC name is (7S)-3-[(E)-hydroxyiminomethyl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one.
| Compound Name | (7S)-3-[(E)-hydroxyiminomethyl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
|---|---|
| PubChem CID | 118696560 |
| Molecular Formula | C15H13F3N4O2 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (7S)-3-[(E)-hydroxyiminomethyl]-7-methyl-5-[4-(trifluoromethyl)phenyl]-6,7-dihydropyrazolo[1,5-a]pyrazin-4-one |
| SMILES | C[C@H]1CN(c2ccc(C(F)(F)F)cc2)C(=O)c2c(/C=N/O)cnn21 |
| InChI | InChI=1S/C15H13F3N4O2/c1-9-8-21(12-4-2-11(3-5-12)15(16,17)18)14(23)13-10(7-20-24)6-19-22(9)13/h2-7,9,24H,8H2,1H3/b20-7+/t9-/m0/s1 |
| InChIKey | KOUVPCRTSZWJOV-SBZQOHANSA-N |
| XLogP | 2.93 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|