C28H25N3O3S — CID 118696622
3-[(Z)-[5-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,3-thiazol-4-yl]-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylic acid (PubChem CID 118696622) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-[(Z)-[5-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,3-thiazol-4-yl]-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylic acid.
| Compound Name | 3-[(Z)-[5-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,3-thiazol-4-yl]-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylic acid |
|---|---|
| PubChem CID | 118696622 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[(Z)-[5-[2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1,3-thiazol-4-yl]-2-oxo-1H-indol-3-ylidene]methyl]-4,5,6,7-tetrahydro-2H-isoindole-1-carboxylic acid |
| SMILES | C=C(/C=C\C=C/C)c1nc(-c2ccc3c(c2)/C(=C/c2[nH]c(C(=O)O)c4c2CCCC4)C(=O)N3)cs1 |
| InChI | InChI=1S/C28H25N3O3S/c1-3-4-5-8-16(2)27-31-24(15-35-27)17-11-12-22-20(13-17)21(26(32)30-22)14-23-18-9-6-7-10-19(18)25(29-23)28(33)34/h3-5,8,11-15,29H,2,6-7,9-10H2,1H3,(H,30,32)(H,33,34)/b4-3-,8-5-,21-14- |
| InChIKey | NCUPVVJUIOMKDU-XPVJXDEISA-N |
| XLogP | 6.35 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|