C17H30N2 — CID 118696714
1,6-ditert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole (PubChem CID 118696714) has the molecular formula C17H30N2 and a molecular weight of 262.44 g/mol. Its IUPAC name is 1,6-ditert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole.
| Compound Name | 1,6-ditert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole |
|---|---|
| PubChem CID | 118696714 |
| Molecular Formula | C17H30N2 |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1,6-ditert-butyl-4,5,6,7,8,9-hexahydrocycloocta[d]pyrazole |
| SMILES | CC(C)(C)C1CCCc2c(cnn2C(C)(C)C)CC1 |
| InChI | InChI=1S/C17H30N2/c1-16(2,3)14-8-7-9-15-13(10-11-14)12-18-19(15)17(4,5)6/h12,14H,7-11H2,1-6H3 |
| InChIKey | VGJCMHZYTGLUNK-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |