C27H26F3N5O2 — CID 118697047
N-[(4-methylphenyl)methyl]-1-[6-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]azetidine-3-carboxamide (PubChem CID 118697047) has the molecular formula C27H26F3N5O2 and a molecular weight of 509.53 g/mol. Its IUPAC name is N-[(4-methylphenyl)methyl]-1-[6-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]azetidine-3-carboxamide.
| Compound Name | N-[(4-methylphenyl)methyl]-1-[6-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 118697047 |
| Molecular Formula | C27H26F3N5O2 |
| Molecular Weight | 509.53 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | N-[(4-methylphenyl)methyl]-1-[6-[4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]azetidine-3-carboxamide |
| SMILES | Cc1ccc(CNC(=O)C2CN(c3ncnn4cc(-c5ccc(C(C)(O)C(F)(F)F)cc5)cc34)C2)cc1 |
| InChI | InChI=1S/C27H26F3N5O2/c1-17-3-5-18(6-4-17)12-31-25(36)21-13-34(14-21)24-23-11-20(15-35(23)33-16-32-24)19-7-9-22(10-8-19)26(2,37)27(28,29)30/h3-11,15-16,21,37H,12-14H2,1-2H3,(H,31,36) |
| InChIKey | KVBXLUFTELNHOP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |