C26H40F2O2 — CID 118697124
methyl (4R)-2,2-difluoro-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 118697124) has the molecular formula C26H40F2O2 and a molecular weight of 422.60 g/mol. Its IUPAC name is methyl (4R)-2,2-difluoro-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-2,2-difluoro-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 118697124 |
| Molecular Formula | C26H40F2O2 |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | methyl (4R)-2,2-difluoro-4-[(3S,8S,9S,10R,13R,14S,17R)-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | COC(=O)C(F)(F)C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](C)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40F2O2/c1-16-10-12-24(3)18(14-16)6-7-19-21-9-8-20(25(21,4)13-11-22(19)24)17(2)15-26(27,28)23(29)30-5/h6,16-17,19-22H,7-15H2,1-5H3/t16-,17+,19-,20+,21-,22-,24-,25+/m0/s1 |
| InChIKey | ZGPSJJKVILZGQG-HGLLBYETSA-N |
| XLogP | 7.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|