C15H11BrNO4- — CID 11869741
(1R,5S,6R,7S)-3-(2-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate (PubChem CID 11869741) has the molecular formula C15H11BrNO4- and a molecular weight of 349.16 g/mol. Its IUPAC name is (1R,5S,6R,7S)-3-(2-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate.
| Compound Name | (1R,5S,6R,7S)-3-(2-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
|---|---|
| PubChem CID | 11869741 |
| Molecular Formula | C15H11BrNO4- |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | (1R,5S,6R,7S)-3-(2-bromophenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylate |
| SMILES | O=C([O-])[C@H]1[C@@H]2C=C[C@@]3(CN(c4ccccc4Br)C(=O)[C@@H]13)O2 |
| InChI | InChI=1S/C15H12BrNO4/c16-8-3-1-2-4-9(8)17-7-15-6-5-10(21-15)11(14(19)20)12(15)13(17)18/h1-6,10-12H,7H2,(H,19,20)/p-1/t10-,11-,12+,15-/m0/s1 |
| InChIKey | YSWNWJUKLUOERO-OHTBPHCPSA-M |
| XLogP | 0.49 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|