C30H33I3N6O6 — CID 118697659
methyl 6-[[4,7-bis[(4-iodo-6-methoxycarbonyl-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-iodopyridine-2-carboxylate (PubChem CID 118697659) has the molecular formula C30H33I3N6O6 and a molecular weight of 954.34 g/mol. Its IUPAC name is methyl 6-[[4,7-bis[(4-iodo-6-methoxycarbonyl-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-iodopyridine-2-carboxylate.
| Compound Name | methyl 6-[[4,7-bis[(4-iodo-6-methoxycarbonyl-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-iodopyridine-2-carboxylate |
|---|---|
| PubChem CID | 118697659 |
| Molecular Formula | C30H33I3N6O6 |
| Molecular Weight | 954.34 g/mol |
| Exact Mass | 953.96 |
| IUPAC Name | methyl 6-[[4,7-bis[(4-iodo-6-methoxycarbonyl-2-pyridinyl)methyl]-1,4,7-triazonan-1-yl]methyl]-4-iodopyridine-2-carboxylate |
| SMILES | COC(=O)c1cc(I)cc(CN2CCN(Cc3cc(I)cc(C(=O)OC)n3)CCN(Cc3cc(I)cc(C(=O)OC)n3)CC2)n1 |
| InChI | InChI=1S/C30H33I3N6O6/c1-43-28(40)25-13-19(31)10-22(34-25)16-37-4-6-38(17-23-11-20(32)14-26(35-23)29(41)44-2)8-9-39(7-5-37)18-24-12-21(33)15-27(36-24)30(42)45-3/h10-15H,4-9,16-18H2,1-3H3 |
| InChIKey | OKTOJJVZQKAFSS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 127.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.34 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|