C19H20ClN5 — CID 118697800
2-chloro-7,9,9-trimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridine (PubChem CID 118697800) has the molecular formula C19H20ClN5 and a molecular weight of 353.86 g/mol. Its IUPAC name is 2-chloro-7,9,9-trimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridine.
| Compound Name | 2-chloro-7,9,9-trimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridine |
|---|---|
| PubChem CID | 118697800 |
| Molecular Formula | C19H20ClN5 |
| Molecular Weight | 353.86 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-chloro-7,9,9-trimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridine |
| SMILES | Cc1ccc2c(c1)C(C)(C)c1cc(Cl)ccc1N2CCc1nn[nH]n1 |
| InChI | InChI=1S/C19H20ClN5/c1-12-4-6-16-14(10-12)19(2,3)15-11-13(20)5-7-17(15)25(16)9-8-18-21-23-24-22-18/h4-7,10-11H,8-9H2,1-3H3,(H,21,22,23,24) |
| InChIKey | DZVLYMLXGQMAGE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |