About 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine
2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine (PubChem CID 118697840) has the molecular formula C18H19ClN6
and a molecular weight of 354.85 g/mol. Its IUPAC name is 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine.
Molecular Properties
| Compound Name | 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine |
| PubChem CID | 118697840 |
| Molecular Formula | C18H19ClN6 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine |
| SMILES | Cc1ccc2c(c1)C(C)(N)c1cc(Cl)ccc1N2CCc1nn[nH]n1 |
| InChI | InChI=1S/C18H19ClN6/c1-11-3-5-15-13(9-11)18(2,20)14-10-12(19)4-6-16(14)25(15)8-7-17-21-23-24-22-17/h3-6,9-10H,7-8,20H2,1-2H3,(H,21,22,23,24) |
| InChIKey | OXPAFWYBMZUFOO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine?
The IUPAC name of 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine (CID 118697840) is 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine.
What is the SMILES notation for 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine?
The canonical SMILES for 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine is Cc1ccc2c(c1)C(C)(N)c1cc(Cl)ccc1N2CCc1nn[nH]n1.
What is the InChIKey of 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine?
The InChIKey is OXPAFWYBMZUFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN6/c1-11-3-5-15-13(9-11)18(2,20)14-10-12(19)4-6-16(14)25(15)8-7-17-21-23-24-22-17/h3-6,9-10H,7-8,20H2,1-2H3,(H,21,22,23,24).
What are the key properties of 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine?
2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine has a molecular weight of 354.85 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-7,9-dimethyl-10-[2-(2H-tetrazol-5-yl)ethyl]acridin-9-amine is sourced from PubChem (CID 118697840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).