C13H14NO4- — CID 11869835
4-[(1R,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]butanoate (PubChem CID 11869835) has the molecular formula C13H14NO4- and a molecular weight of 248.26 g/mol. Its IUPAC name is 4-[(1R,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]butanoate.
| Compound Name | 4-[(1R,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]butanoate |
|---|---|
| PubChem CID | 11869835 |
| Molecular Formula | C13H14NO4- |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 4-[(1R,2R,6R,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]butanoate |
| SMILES | O=C([O-])CCCN1C(=O)[C@H]2[C@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H15NO4/c15-9(16)2-1-5-14-12(17)10-7-3-4-8(6-7)11(10)13(14)18/h3-4,7-8,10-11H,1-2,5-6H2,(H,15,16)/p-1/t7-,8+,10-,11-/m1/s1 |
| InChIKey | WGPBWBNVJMUVEK-JZSSXWJLSA-M |
| XLogP | -0.68 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|