C53H106Br2O2 — CID 118698922
4-[3-[5-(4-bromobutan-2-yl)-6,6,7,7-tetramethyloctoxy]propyl]-5-(2-bromoethyl)-2,2,3,3,7,7,8,8-octamethyl-6-[3-(6,6,7,7-tetramethyloctoxy)propyl]nonane (PubChem CID 118698922) has the molecular formula C53H106Br2O2 and a molecular weight of 935.24 g/mol. Its IUPAC name is 4-[3-[5-(4-bromobutan-2-yl)-6,6,7,7-tetramethyloctoxy]propyl]-5-(2-bromoethyl)-2,2,3,3,7,7,8,8-octamethyl-6-[3-(6,6,7,7-tetramethyloctoxy)propyl]nonane.
| Compound Name | 4-[3-[5-(4-bromobutan-2-yl)-6,6,7,7-tetramethyloctoxy]propyl]-5-(2-bromoethyl)-2,2,3,3,7,7,8,8-octamethyl-6-[3-(6,6,7,7-tetramethyloctoxy)propyl]nonane |
|---|---|
| PubChem CID | 118698922 |
| Molecular Formula | C53H106Br2O2 |
| Molecular Weight | 935.24 g/mol |
| Exact Mass | 932.66 |
| IUPAC Name | 4-[3-[5-(4-bromobutan-2-yl)-6,6,7,7-tetramethyloctoxy]propyl]-5-(2-bromoethyl)-2,2,3,3,7,7,8,8-octamethyl-6-[3-(6,6,7,7-tetramethyloctoxy)propyl]nonane |
| SMILES | CC(CCBr)C(CCCCOCCCC(C(CCBr)C(CCCOCCCCCC(C)(C)C(C)(C)C)C(C)(C)C(C)(C)C)C(C)(C)C(C)(C)C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C53H106Br2O2/c1-41(32-35-54)43(51(16,17)47(5,6)7)29-23-26-38-57-40-28-31-45(53(20,21)49(11,12)13)42(33-36-55)44(52(18,19)48(8,9)10)30-27-39-56-37-25-22-24-34-50(14,15)46(2,3)4/h41-45H,22-40H2,1-21H3 |
| InChIKey | RKXNDHDIJUJQKT-UHFFFAOYSA-N |
| XLogP | 18.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.24 |
| LogP ≤ 5 | 18.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|