C22H30F10O4 — CID 118699030
tert-butyl 4,4,5,5-tetrafluoro-2-methyl-5-[3-methyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]-2-bicyclo[2.2.1]heptanyl]pentanoate (PubChem CID 118699030) has the molecular formula C22H30F10O4 and a molecular weight of 548.46 g/mol. Its IUPAC name is tert-butyl 4,4,5,5-tetrafluoro-2-methyl-5-[3-methyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]-2-bicyclo[2.2.1]heptanyl]pentanoate.
| Compound Name | tert-butyl 4,4,5,5-tetrafluoro-2-methyl-5-[3-methyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]-2-bicyclo[2.2.1]heptanyl]pentanoate |
|---|---|
| PubChem CID | 118699030 |
| Molecular Formula | C22H30F10O4 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | tert-butyl 4,4,5,5-tetrafluoro-2-methyl-5-[3-methyl-5-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propoxy]-2-bicyclo[2.2.1]heptanyl]pentanoate |
| SMILES | CC(CC(F)(F)C(F)(F)C1C2CC(OCC(O)(C(F)(F)F)C(F)(F)F)C(C2)C1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30F10O4/c1-10(16(33)36-17(3,4)5)8-19(23,24)20(25,26)15-11(2)13-6-12(15)7-14(13)35-9-18(34,21(27,28)29)22(30,31)32/h10-15,34H,6-9H2,1-5H3 |
| InChIKey | KJEOFCGWKHTLRL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|