C10H16N2 — CID 118699358
(5R)-5-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole (PubChem CID 118699358) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is (5R)-5-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole.
| Compound Name | (5R)-5-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole |
|---|---|
| PubChem CID | 118699358 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | (5R)-5-propan-2-yl-4,5,6,7-tetrahydro-1H-indazole |
| SMILES | CC(C)[C@@H]1CCc2[nH]ncc2C1 |
| InChI | InChI=1S/C10H16N2/c1-7(2)8-3-4-10-9(5-8)6-11-12-10/h6-8H,3-5H2,1-2H3,(H,11,12)/t8-/m1/s1 |
| InChIKey | JECUVWLLGKRWRV-MRVPVSSYSA-N |
| XLogP | 2.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |