C20H22F3N3O3 — CID 118700446
N-[4-[(2S,3R,6R)-3,6-dimethylmorpholin-2-yl]phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide (PubChem CID 118700446) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is N-[4-[(2S,3R,6R)-3,6-dimethylmorpholin-2-yl]phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide.
| Compound Name | N-[4-[(2S,3R,6R)-3,6-dimethylmorpholin-2-yl]phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118700446 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[4-[(2S,3R,6R)-3,6-dimethylmorpholin-2-yl]phenyl]-6-(2,2,2-trifluoroethoxy)pyridine-3-carboxamide |
| SMILES | C[C@@H]1CN[C@H](C)[C@H](c2ccc(NC(=O)c3ccc(OCC(F)(F)F)nc3)cc2)O1 |
| InChI | InChI=1S/C20H22F3N3O3/c1-12-9-24-13(2)18(29-12)14-3-6-16(7-4-14)26-19(27)15-5-8-17(25-10-15)28-11-20(21,22)23/h3-8,10,12-13,18,24H,9,11H2,1-2H3,(H,26,27)/t12-,13-,18-/m1/s1 |
| InChIKey | GKGYAYAHVXRRTL-SNUQEOBHSA-N |
| XLogP | 3.71 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |