C25H30N2O3 — CID 118700846
5-[(3Z,5Z)-7-methoxy-2-methylidenehepta-3,5-dienyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione (PubChem CID 118700846) has the molecular formula C25H30N2O3 and a molecular weight of 406.53 g/mol. Its IUPAC name is 5-[(3Z,5Z)-7-methoxy-2-methylidenehepta-3,5-dienyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(3Z,5Z)-7-methoxy-2-methylidenehepta-3,5-dienyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118700846 |
| Molecular Formula | C25H30N2O3 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | 5-[(3Z,5Z)-7-methoxy-2-methylidenehepta-3,5-dienyl]-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione |
| SMILES | C=C(/C=C\C=C/COC)Cc1c(C2CCC(c3ccccc3)CC2)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H30N2O3/c1-18(9-5-4-8-16-30-2)17-22-23(26-25(29)27-24(22)28)21-14-12-20(13-15-21)19-10-6-3-7-11-19/h3-11,20-21H,1,12-17H2,2H3,(H2,26,27,28,29)/b8-4-,9-5- |
| InChIKey | RECFYIMKJUPZRY-XEQVNJCQSA-N |
| XLogP | 4.36 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|