C10H14FN5 — CID 118700898
(6R)-3-fluoro-5,6,12-trimethyl-2,4,7,9,11-pentazabicyclo[6.3.1]dodeca-1(11),3,8(12),9-tetraene (PubChem CID 118700898) has the molecular formula C10H14FN5 and a molecular weight of 223.25 g/mol. Its IUPAC name is (6R)-3-fluoro-5,6,12-trimethyl-2,4,7,9,11-pentazabicyclo[6.3.1]dodeca-1(11),3,8(12),9-tetraene.
| Compound Name | (6R)-3-fluoro-5,6,12-trimethyl-2,4,7,9,11-pentazabicyclo[6.3.1]dodeca-1(11),3,8(12),9-tetraene |
|---|---|
| PubChem CID | 118700898 |
| Molecular Formula | C10H14FN5 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (6R)-3-fluoro-5,6,12-trimethyl-2,4,7,9,11-pentazabicyclo[6.3.1]dodeca-1(11),3,8(12),9-tetraene |
| SMILES | Cc1c2ncnc1N[C@H](C)C(C)/N=C(/F)N2 |
| InChI | InChI=1S/C10H14FN5/c1-5-8-12-4-13-9(5)16-10(11)15-7(3)6(2)14-8/h4,6-7H,1-3H3,(H2,12,13,14,15,16)/t6-,7?/m1/s1 |
| InChIKey | IQTQGMDJVMOYGI-ULUSZKPHSA-N |
| XLogP | 1.72 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|