C26H44O4 — CID 118701772
(6R)-6-[(3R,5R,6R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid (PubChem CID 118701772) has the molecular formula C26H44O4 and a molecular weight of 420.63 g/mol. Its IUPAC name is (6R)-6-[(3R,5R,6R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid.
| Compound Name | (6R)-6-[(3R,5R,6R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
|---|---|
| PubChem CID | 118701772 |
| Molecular Formula | C26H44O4 |
| Molecular Weight | 420.63 g/mol |
| Exact Mass | 420.32 |
| IUPAC Name | (6R)-6-[(3R,5R,6R,8S,9S,10R,13R,14S,17R)-3,6-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid |
| SMILES | C[C@H](CCCCC(=O)O)[C@H]1CC[C@H]2[C@@H]3C[C@@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H44O4/c1-16(6-4-5-7-24(29)30)19-8-9-20-18-15-23(28)22-14-17(27)10-12-26(22,3)21(18)11-13-25(19,20)2/h16-23,27-28H,4-15H2,1-3H3,(H,29,30)/t16-,17-,18+,19-,20+,21+,22+,23-,25-,26-/m1/s1 |
| InChIKey | VIVZSRXQGPIYIQ-CZNXQHJVSA-N |
| XLogP | 5.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.63 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|