C17H27BF3NO4 — CID 118703808
[(1R)-1-amino-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl] 2,2,2-trifluoroacetate (PubChem CID 118703808) has the molecular formula C17H27BF3NO4 and a molecular weight of 377.21 g/mol. Its IUPAC name is [(1R)-1-amino-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R)-1-amino-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118703808 |
| Molecular Formula | C17H27BF3NO4 |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [(1R)-1-amino-3-methyl-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]butyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)C[C@](N)(OC(=O)C(F)(F)F)B1O[C@@H]2C[C@@H]3C[C@@H](C3(C)C)[C@]2(C)O1 |
| InChI | InChI=1S/C17H27BF3NO4/c1-9(2)8-16(22,24-13(23)17(19,20)21)18-25-12-7-10-6-11(14(10,3)4)15(12,5)26-18/h9-12H,6-8,22H2,1-5H3/t10-,11-,12+,15-,16-/m0/s1 |
| InChIKey | ZPSPQFNTBAWSPQ-LZPUHMRESA-N |
| XLogP | 3.06 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|