methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate

C16H22O4 — CID 118703897

IUPACmethyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate
SMILESCOC(=O)C(C)c1ccc(C(=O)CC(C)(C)C)c(O)c1
InChIInChI=1S/C16H22O4/c1-10(15(19)20-5)11-6-7-12(13(17)8-11)14(18)9-16(2,3)4/h6-8,10,17H,9H2,1-5H3
InChIKeyDVYBXAFLGWQUSI-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.29
Rot. Bonds4

About methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate

methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate (PubChem CID 118703897) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate.

Molecular Properties

Compound Namemethyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate
PubChem CID118703897
Molecular FormulaC16H22O4
Molecular Weight278.35 g/mol
Exact Mass278.15
IUPAC Namemethyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate
SMILESCOC(=O)C(C)c1ccc(C(=O)CC(C)(C)C)c(O)c1
InChIInChI=1S/C16H22O4/c1-10(15(19)20-5)11-6-7-12(13(17)8-11)14(18)9-16(2,3)4/h6-8,10,17H,9H2,1-5H3
InChIKeyDVYBXAFLGWQUSI-UHFFFAOYSA-N
XLogP3.29
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.29
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate?
The IUPAC name of methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate (CID 118703897) is methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate.
What is the SMILES notation for methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate?
The canonical SMILES for methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate is COC(=O)C(C)c1ccc(C(=O)CC(C)(C)C)c(O)c1.
What is the InChIKey of methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate?
The InChIKey is DVYBXAFLGWQUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-10(15(19)20-5)11-6-7-12(13(17)8-11)14(18)9-16(2,3)4/h6-8,10,17H,9H2,1-5H3.
What are the key properties of methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate?
methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate has a molecular weight of 278.35 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[4-(3,3-dimethylbutanoyl)-3-hydroxyphenyl]propanoate is sourced from PubChem (CID 118703897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).