About 8-fluoro-5H-imidazo[5,1-a]isoindole
8-fluoro-5H-imidazo[5,1-a]isoindole (PubChem CID 118704528) has the molecular formula C10H7FN2
and a molecular weight of 174.18 g/mol. Its IUPAC name is 8-fluoro-5H-imidazo[5,1-a]isoindole.
Molecular Properties
| Compound Name | 8-fluoro-5H-imidazo[5,1-a]isoindole |
| PubChem CID | 118704528 |
| Molecular Formula | C10H7FN2 |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 8-fluoro-5H-imidazo[5,1-a]isoindole |
| SMILES | Fc1ccc2c(c1)-c1cncn1C2 |
| InChI | InChI=1S/C10H7FN2/c11-8-2-1-7-5-13-6-12-4-10(13)9(7)3-8/h1-4,6H,5H2 |
| InChIKey | SFWMMCAUXNGTQU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-5H-imidazo[5,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5H-imidazo[5,1-a]isoindole?
The IUPAC name of 8-fluoro-5H-imidazo[5,1-a]isoindole (CID 118704528) is 8-fluoro-5H-imidazo[5,1-a]isoindole.
What is the SMILES notation for 8-fluoro-5H-imidazo[5,1-a]isoindole?
The canonical SMILES for 8-fluoro-5H-imidazo[5,1-a]isoindole is Fc1ccc2c(c1)-c1cncn1C2.
What is the InChIKey of 8-fluoro-5H-imidazo[5,1-a]isoindole?
The InChIKey is SFWMMCAUXNGTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7FN2/c11-8-2-1-7-5-13-6-12-4-10(13)9(7)3-8/h1-4,6H,5H2.
What are the key properties of 8-fluoro-5H-imidazo[5,1-a]isoindole?
8-fluoro-5H-imidazo[5,1-a]isoindole has a molecular weight of 174.18 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5H-imidazo[5,1-a]isoindole is sourced from PubChem (CID 118704528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).