C9H8BBrF4KNO — CID 118704617
potassium [3-(5-bromo-2-fluoroanilino)-3-oxopropyl]-trifluoroboranuide (PubChem CID 118704617) has the molecular formula C9H8BBrF4KNO and a molecular weight of 351.98 g/mol. Its IUPAC name is potassium [3-(5-bromo-2-fluoroanilino)-3-oxopropyl]-trifluoroboranuide.
| Compound Name | potassium [3-(5-bromo-2-fluoroanilino)-3-oxopropyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 118704617 |
| Molecular Formula | C9H8BBrF4KNO |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | potassium [3-(5-bromo-2-fluoroanilino)-3-oxopropyl]-trifluoroboranuide |
| SMILES | O=C(CC[B-](F)(F)F)Nc1cc(Br)ccc1F.[K+] |
| InChI | InChI=1S/C9H8BBrF4NO.K/c11-6-1-2-7(12)8(5-6)16-9(17)3-4-10(13,14)15;/h1-2,5H,3-4H2,(H,16,17);/q-1;+1 |
| InChIKey | VWAOLWKLWSVCNY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|