C25H19N5O3 — CID 118704643
3-furo[2,3-b]pyridin-3-yl-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione (PubChem CID 118704643) has the molecular formula C25H19N5O3 and a molecular weight of 437.46 g/mol. Its IUPAC name is 3-furo[2,3-b]pyridin-3-yl-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-furo[2,3-b]pyridin-3-yl-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118704643 |
| Molecular Formula | C25H19N5O3 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 3-furo[2,3-b]pyridin-3-yl-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn(CCCn3ccnc3)c3ccccc23)=C1c1coc2ncccc12 |
| InChI | InChI=1S/C25H19N5O3/c31-23-21(22(24(32)28-23)19-14-33-25-17(19)6-3-8-27-25)18-13-30(20-7-2-1-5-16(18)20)11-4-10-29-12-9-26-15-29/h1-3,5-9,12-15H,4,10-11H2,(H,28,31,32) |
| InChIKey | MHIHFTFFTDQVFQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|