C25H22FN3O2 — CID 118704695
7-[4-cyclobutyl-2-fluoro-3-[(4-isocyanophenyl)methoxy]phenyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine (PubChem CID 118704695) has the molecular formula C25H22FN3O2 and a molecular weight of 415.47 g/mol. Its IUPAC name is 7-[4-cyclobutyl-2-fluoro-3-[(4-isocyanophenyl)methoxy]phenyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine.
| Compound Name | 7-[4-cyclobutyl-2-fluoro-3-[(4-isocyanophenyl)methoxy]phenyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 118704695 |
| Molecular Formula | C25H22FN3O2 |
| Molecular Weight | 415.47 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 7-[4-cyclobutyl-2-fluoro-3-[(4-isocyanophenyl)methoxy]phenyl]-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine |
| SMILES | [C-]#[N+]c1ccc(COc2c(C3CCC3)ccc(-c3cnc4c(c3)OCCN4)c2F)cc1 |
| InChI | InChI=1S/C25H22FN3O2/c1-27-19-7-5-16(6-8-19)15-31-24-21(17-3-2-4-17)10-9-20(23(24)26)18-13-22-25(29-14-18)28-11-12-30-22/h5-10,13-14,17H,2-4,11-12,15H2,(H,28,29) |
| InChIKey | GYFQWBZHKCPKQG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 47.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.47 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|