About (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one
(7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one (PubChem CID 118704889) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one.
Molecular Properties
| Compound Name | (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one |
| PubChem CID | 118704889 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one |
| SMILES | O=C1CC2C=CC=C[C@H]2O1 |
| InChI | InChI=1S/C8H8O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4,6-7H,5H2/t6?,7-/m1/s1 |
| InChIKey | NGZFKZDNHHHFMO-COBSHVIPSA-N |
| XLogP | 1.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one?
The IUPAC name of (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one (CID 118704889) is (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one.
What is the SMILES notation for (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one?
The canonical SMILES for (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one is O=C1CC2C=CC=C[C@H]2O1.
What is the InChIKey of (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one?
The InChIKey is NGZFKZDNHHHFMO-COBSHVIPSA-N. The full InChI is InChI=1S/C8H8O2/c9-8-5-6-3-1-2-4-7(6)10-8/h1-4,6-7H,5H2/t6?,7-/m1/s1.
What are the key properties of (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one?
(7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one has a molecular weight of 136.15 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7aR)-3a,7a-dihydro-3H-1-benzofuran-2-one is sourced from PubChem (CID 118704889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).