C19H13N5OS — CID 1187050
8-hydrazinyl-13-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one (PubChem CID 1187050) has the molecular formula C19H13N5OS and a molecular weight of 359.41 g/mol. Its IUPAC name is 8-hydrazinyl-13-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one.
| Compound Name | 8-hydrazinyl-13-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
|---|---|
| PubChem CID | 1187050 |
| Molecular Formula | C19H13N5OS |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 8-hydrazinyl-13-phenyl-15-thia-9,10,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,8,12(16),13-heptaen-11-one |
| SMILES | NNc1nn2c(=O)c3c(-c4ccccc4)csc3nc2c2ccccc12 |
| InChI | InChI=1S/C19H13N5OS/c20-22-16-12-8-4-5-9-13(12)17-21-18-15(19(25)24(17)23-16)14(10-26-18)11-6-2-1-3-7-11/h1-10H,20H2,(H,22,23) |
| InChIKey | FBLIRCJQIUJIBX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|