About 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine
2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 118705106) has the molecular formula C21H14FN3
and a molecular weight of 327.36 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine |
| PubChem CID | 118705106 |
| Molecular Formula | C21H14FN3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Fc1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C21H14FN3/c22-18-13-7-12-17(14-18)21-24-19(15-8-3-1-4-9-15)23-20(25-21)16-10-5-2-6-11-16/h1-14H |
| InChIKey | MFPXLFOIDYQLFN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine?
The IUPAC name of 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine (CID 118705106) is 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine.
What is the SMILES notation for 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine?
The canonical SMILES for 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine is Fc1cccc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1.
What is the InChIKey of 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine?
The InChIKey is MFPXLFOIDYQLFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14FN3/c22-18-13-7-12-17(14-18)21-24-19(15-8-3-1-4-9-15)23-20(25-21)16-10-5-2-6-11-16/h1-14H.
What are the key properties of 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine?
2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine has a molecular weight of 327.36 g/mol, XLogP of 5.01, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-4,6-diphenyl-1,3,5-triazine is sourced from PubChem (CID 118705106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).