C24H29FN4O4Si — CID 118705188
ethyl 4-[2-fluoro-5-(prop-2-enoylamino)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 118705188) has the molecular formula C24H29FN4O4Si and a molecular weight of 484.60 g/mol. Its IUPAC name is ethyl 4-[2-fluoro-5-(prop-2-enoylamino)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[2-fluoro-5-(prop-2-enoylamino)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 118705188 |
| Molecular Formula | C24H29FN4O4Si |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl 4-[2-fluoro-5-(prop-2-enoylamino)phenyl]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | C=CC(=O)Nc1ccc(F)c(-c2ncnc3c2c(C(=O)OCC)cn3COCC[Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H29FN4O4Si/c1-6-20(30)28-16-8-9-19(25)17(12-16)22-21-18(24(31)33-7-2)13-29(23(21)27-14-26-22)15-32-10-11-34(3,4)5/h6,8-9,12-14H,1,7,10-11,15H2,2-5H3,(H,28,30) |
| InChIKey | TVLFQWUADWIWQC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|