C33H39N5O7S2 — CID 118705520
4-methylbenzenesulfonate;4-methylbenzenesulfonic acid;N'-[(E)-[4-[(1-methylpyridin-1-ium-4-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide (PubChem CID 118705520) has the molecular formula C33H39N5O7S2 and a molecular weight of 681.80 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;4-methylbenzenesulfonic acid;N'-[(E)-[4-[(1-methylpyridin-1-ium-4-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide.
| Compound Name | 4-methylbenzenesulfonate;4-methylbenzenesulfonic acid;N'-[(E)-[4-[(1-methylpyridin-1-ium-4-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 118705520 |
| Molecular Formula | C33H39N5O7S2 |
| Molecular Weight | 681.80 g/mol |
| Exact Mass | 681.23 |
| IUPAC Name | 4-methylbenzenesulfonate;4-methylbenzenesulfonic acid;N'-[(E)-[4-[(1-methylpyridin-1-ium-4-yl)methoxy]phenyl]methylideneamino]pyrrolidine-1-carboximidamide |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)[O-].C[N+]1=CC=C(C=C1)COC2=CC=C(C=C2)/C=N/N=C(/N)\N3CCCC3 |
| InChI | InChI=1S/C19H24N5O.2C7H8O3S/c1-23-12-8-17(9-13-23)15-25-18-6-4-16(5-7-18)14-21-22-19(20)24-10-2-3-11-24;2*1-6-2-4-7(5-3-6)11(8,9)10/h4-9,12-14H,2-3,10-11,15H2,1H3,(H2,20,22);2*2-5H,1H3,(H,8,9,10)/q+1;;/p-1/b21-14+;; |
| InChIKey | XUHDRTHPWYZZRT-NZYGGCLTSA-M |
| XLogP | — |
| TPSA | 195.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | 844 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|