C17H25NO3 — CID 11870561
(1R,3S,6S,7R,10S,11R)-7-[(dimethylamino)methyl]-3,12-dimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one (PubChem CID 11870561) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is (1R,3S,6S,7R,10S,11R)-7-[(dimethylamino)methyl]-3,12-dimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one.
| Compound Name | (1R,3S,6S,7R,10S,11R)-7-[(dimethylamino)methyl]-3,12-dimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one |
|---|---|
| PubChem CID | 11870561 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | (1R,3S,6S,7R,10S,11R)-7-[(dimethylamino)methyl]-3,12-dimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradec-12-en-8-one |
| SMILES | CC1=CC[C@]23O[C@@]2(C)CC[C@@H]2[C@H](OC(=O)[C@H]2CN(C)C)[C@@H]13 |
| InChI | InChI=1S/C17H25NO3/c1-10-5-8-17-13(10)14-11(6-7-16(17,2)21-17)12(9-18(3)4)15(19)20-14/h5,11-14H,6-9H2,1-4H3/t11-,12-,13+,14-,16-,17+/m0/s1 |
| InChIKey | QPLBGBUETBAFIV-MYDCDKHLSA-N |
| XLogP | 1.99 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|