About N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid
N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid (PubChem CID 118705654) has the molecular formula C11H20N2S3
and a molecular weight of 276.50 g/mol. Its IUPAC name is N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid.
Molecular Properties
| Compound Name | N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid |
| PubChem CID | 118705654 |
| Molecular Formula | C11H20N2S3 |
| Molecular Weight | 276.50 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid |
| SMILES | CCN(CC)CC.S=C(S)Nc1cccs1 |
| InChI | InChI=1S/C6H15N.C5H5NS3/c1-4-7(5-2)6-3;7-5(8)6-4-2-1-3-9-4/h4-6H2,1-3H3;1-3H,(H2,6,7,8) |
| InChIKey | HZCBXHIVZCSMSF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
The IUPAC name of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid (CID 118705654) is N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid.
What is the SMILES notation for N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
The canonical SMILES for N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid is CCN(CC)CC.S=C(S)Nc1cccs1.
What is the InChIKey of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
The InChIKey is HZCBXHIVZCSMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H5NS3/c1-4-7(5-2)6-3;7-5(8)6-4-2-1-3-9-4/h4-6H2,1-3H3;1-3H,(H2,6,7,8).
What are the key properties of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid has a molecular weight of 276.50 g/mol, XLogP of 3.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid is sourced from PubChem (CID 118705654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).