N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid

C11H20N2S3 — CID 118705654

IUPACN,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid
SMILESCCN(CC)CC.S=C(S)Nc1cccs1
InChIInChI=1S/C6H15N.C5H5NS3/c1-4-7(5-2)6-3;7-5(8)6-4-2-1-3-9-4/h4-6H2,1-3H3;1-3H,(H2,6,7,8)
InChIKeyHZCBXHIVZCSMSF-UHFFFAOYSA-N
MW276.50 g/mol
LogP3.72
Rot. Bonds4

About N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid

N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid (PubChem CID 118705654) has the molecular formula C11H20N2S3 and a molecular weight of 276.50 g/mol. Its IUPAC name is N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid.

Molecular Properties

Compound NameN,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid
PubChem CID118705654
Molecular FormulaC11H20N2S3
Molecular Weight276.50 g/mol
Exact Mass276.08
IUPAC NameN,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid
SMILESCCN(CC)CC.S=C(S)Nc1cccs1
InChIInChI=1S/C6H15N.C5H5NS3/c1-4-7(5-2)6-3;7-5(8)6-4-2-1-3-9-4/h4-6H2,1-3H3;1-3H,(H2,6,7,8)
InChIKeyHZCBXHIVZCSMSF-UHFFFAOYSA-N
XLogP3.72
TPSA15.27 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.50
LogP ≤ 53.72
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}

Analyze N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
The IUPAC name of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid (CID 118705654) is N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid.
What is the SMILES notation for N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
The canonical SMILES for N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid is CCN(CC)CC.S=C(S)Nc1cccs1.
What is the InChIKey of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
The InChIKey is HZCBXHIVZCSMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C5H5NS3/c1-4-7(5-2)6-3;7-5(8)6-4-2-1-3-9-4/h4-6H2,1-3H3;1-3H,(H2,6,7,8).
What are the key properties of N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid?
N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid has a molecular weight of 276.50 g/mol, XLogP of 3.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;thiophen-2-ylcarbamodithioic acid is sourced from PubChem (CID 118705654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).