About 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole
6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole (PubChem CID 118705895) has the molecular formula C19H19NO6
and a molecular weight of 357.36 g/mol. Its IUPAC name is 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole |
| PubChem CID | 118705895 |
| Molecular Formula | C19H19NO6 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole |
| SMILES | CCOc1nc2ccc(OCCCOc3ccc4c(c3)OCO4)cc2o1 |
| InChI | InChI=1S/C19H19NO6/c1-2-21-19-20-15-6-4-13(10-17(15)26-19)22-8-3-9-23-14-5-7-16-18(11-14)25-12-24-16/h4-7,10-11H,2-3,8-9,12H2,1H3 |
| InChIKey | PHAUNPZZPOUTIW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole?
The IUPAC name of 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole (CID 118705895) is 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole.
What is the SMILES notation for 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole?
The canonical SMILES for 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole is CCOc1nc2ccc(OCCCOc3ccc4c(c3)OCO4)cc2o1.
What is the InChIKey of 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole?
The InChIKey is PHAUNPZZPOUTIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO6/c1-2-21-19-20-15-6-4-13(10-17(15)26-19)22-8-3-9-23-14-5-7-16-18(11-14)25-12-24-16/h4-7,10-11H,2-3,8-9,12H2,1H3.
What are the key properties of 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole?
6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole has a molecular weight of 357.36 g/mol, XLogP of 3.80, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(1,3-benzodioxol-5-yloxy)propoxy]-2-ethoxy-1,3-benzoxazole is sourced from PubChem (CID 118705895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).