C17H19N3O — CID 118705920
3,5-dimethyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-1,2-oxazole (PubChem CID 118705920) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 3,5-dimethyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-1,2-oxazole.
| Compound Name | 3,5-dimethyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 118705920 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 3,5-dimethyl-4-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-ylmethyl)-1,2-oxazole |
| SMILES | Cc1noc(C)c1CN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C17H19N3O/c1-11-15(12(2)21-19-11)9-20-8-7-14-13-5-3-4-6-16(13)18-17(14)10-20/h3-6,18H,7-10H2,1-2H3 |
| InChIKey | QWFSMCSCJZRPIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|