C24H16FN3O3 — CID 118705996
21-(2-fluoro-5-methoxyphenyl)-18-oxa-6,9,15-triazapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1,3,5,7,9,11,13,16(20)-octaen-19-one (PubChem CID 118705996) has the molecular formula C24H16FN3O3 and a molecular weight of 413.41 g/mol. Its IUPAC name is 21-(2-fluoro-5-methoxyphenyl)-18-oxa-6,9,15-triazapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1,3,5,7,9,11,13,16(20)-octaen-19-one.
| Compound Name | 21-(2-fluoro-5-methoxyphenyl)-18-oxa-6,9,15-triazapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1,3,5,7,9,11,13,16(20)-octaen-19-one |
|---|---|
| PubChem CID | 118705996 |
| Molecular Formula | C24H16FN3O3 |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 21-(2-fluoro-5-methoxyphenyl)-18-oxa-6,9,15-triazapentacyclo[12.7.0.02,7.08,13.016,20]henicosa-1,3,5,7,9,11,13,16(20)-octaen-19-one |
| SMILES | COc1ccc(F)c(C2C3=C(COC3=O)Nc3c2c2cccnc2c2ncccc32)c1 |
| InChI | InChI=1S/C24H16FN3O3/c1-30-12-6-7-16(25)15(10-12)18-19-13-4-2-8-26-22(13)23-14(5-3-9-27-23)21(19)28-17-11-31-24(29)20(17)18/h2-10,18,28H,11H2,1H3 |
| InChIKey | PGUNKTAJAVKLPO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|