C23H32N4O10 — CID 118706016
(2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)benzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid (PubChem CID 118706016) has the molecular formula C23H32N4O10 and a molecular weight of 524.53 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)benzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)benzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 118706016 |
| Molecular Formula | C23H32N4O10 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | (2S)-2-[[(1S)-5-[[2-(2-acetamidoethoxy)benzoyl]amino]-1-carboxypentyl]carbamoylamino]pentanedioic acid |
| SMILES | CC(=O)NCCOc1ccccc1C(=O)NCCCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H32N4O10/c1-14(28)24-12-13-37-18-8-3-2-6-15(18)20(31)25-11-5-4-7-16(21(32)33)26-23(36)27-17(22(34)35)9-10-19(29)30/h2-3,6,8,16-17H,4-5,7,9-13H2,1H3,(H,24,28)(H,25,31)(H,29,30)(H,32,33)(H,34,35)(H2,26,27,36)/t16-,17-/m0/s1 |
| InChIKey | VZMNGCOAPGSFQL-IRXDYDNUSA-N |
| XLogP | 0.17 |
| TPSA | 220.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|