C24H23N5O5 — CID 118706125
ethyl 2-[[4-(4-methylanilino)-6-[(2-oxochromen-3-yl)methoxy]-1,3,5-triazin-2-yl]amino]acetate (PubChem CID 118706125) has the molecular formula C24H23N5O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is ethyl 2-[[4-(4-methylanilino)-6-[(2-oxochromen-3-yl)methoxy]-1,3,5-triazin-2-yl]amino]acetate.
| Compound Name | ethyl 2-[[4-(4-methylanilino)-6-[(2-oxochromen-3-yl)methoxy]-1,3,5-triazin-2-yl]amino]acetate |
|---|---|
| PubChem CID | 118706125 |
| Molecular Formula | C24H23N5O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | ethyl 2-[[4-(4-methylanilino)-6-[(2-oxochromen-3-yl)methoxy]-1,3,5-triazin-2-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1nc(Nc2ccc(C)cc2)nc(OCc2cc3ccccc3oc2=O)n1 |
| InChI | InChI=1S/C24H23N5O5/c1-3-32-20(30)13-25-22-27-23(26-18-10-8-15(2)9-11-18)29-24(28-22)33-14-17-12-16-6-4-5-7-19(16)34-21(17)31/h4-12H,3,13-14H2,1-2H3,(H2,25,26,27,28,29) |
| InChIKey | UWINRTGMJMAIIC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 128.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|