C22H19NO3 — CID 118706334
N-[2-oxo-6-(5,6,7,8-tetrahydronaphthalen-2-yl)pyran-3-yl]benzamide (PubChem CID 118706334) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-[2-oxo-6-(5,6,7,8-tetrahydronaphthalen-2-yl)pyran-3-yl]benzamide.
| Compound Name | N-[2-oxo-6-(5,6,7,8-tetrahydronaphthalen-2-yl)pyran-3-yl]benzamide |
|---|---|
| PubChem CID | 118706334 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-[2-oxo-6-(5,6,7,8-tetrahydronaphthalen-2-yl)pyran-3-yl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ccc3c(c2)CCCC3)oc1=O)c1ccccc1 |
| InChI | InChI=1S/C22H19NO3/c24-21(16-7-2-1-3-8-16)23-19-12-13-20(26-22(19)25)18-11-10-15-6-4-5-9-17(15)14-18/h1-3,7-8,10-14H,4-6,9H2,(H,23,24) |
| InChIKey | QCIUKBRMFPOUOI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |