About bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone
bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone (PubChem CID 118706530) has the molecular formula C23H14N8O
and a molecular weight of 418.42 g/mol. Its IUPAC name is bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone.
Molecular Properties
| Compound Name | bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone |
| PubChem CID | 118706530 |
| Molecular Formula | C23H14N8O |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone |
| SMILES | O=C(c1cccc(-c2nnn3ccccc23)n1)c1cccc(-c2nnn3ccccc23)n1 |
| InChI | InChI=1S/C23H14N8O/c32-23(17-9-5-7-15(24-17)21-19-11-1-3-13-30(19)28-26-21)18-10-6-8-16(25-18)22-20-12-2-4-14-31(20)29-27-22/h1-14H |
| InChIKey | ZMJFJHPGFJFALD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 103.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone?
The IUPAC name of bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone (CID 118706530) is bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone.
What is the SMILES notation for bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone?
The canonical SMILES for bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone is O=C(c1cccc(-c2nnn3ccccc23)n1)c1cccc(-c2nnn3ccccc23)n1.
What is the InChIKey of bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone?
The InChIKey is ZMJFJHPGFJFALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H14N8O/c32-23(17-9-5-7-15(24-17)21-19-11-1-3-13-30(19)28-26-21)18-10-6-8-16(25-18)22-20-12-2-4-14-31(20)29-27-22/h1-14H.
What are the key properties of bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone?
bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone has a molecular weight of 418.42 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis[6-(triazolo[1,5-a]pyridin-3-yl)-2-pyridinyl]methanone is sourced from PubChem (CID 118706530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).